C18H31NO — CID 100913715
4-(2,6-dimethylanilino)-2,2,5,5-tetramethylhexan-3-ol (PubChem CID 100913715) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 4-(2,6-dimethylanilino)-2,2,5,5-tetramethylhexan-3-ol.
| Compound Name | 4-(2,6-dimethylanilino)-2,2,5,5-tetramethylhexan-3-ol |
|---|---|
| PubChem CID | 100913715 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 4-(2,6-dimethylanilino)-2,2,5,5-tetramethylhexan-3-ol |
| SMILES | Cc1cccc(C)c1NC(C(O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H31NO/c1-12-10-9-11-13(2)14(12)19-15(17(3,4)5)16(20)18(6,7)8/h9-11,15-16,19-20H,1-8H3 |
| InChIKey | JBVUDEITVOBKKE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |