C35H38O3 — CID 100913786
5-[(5R,6R)-5-ethenyl-6-trityloxyoct-7-en-1-ynyl]-2,2-dimethyl-1,3-dioxane (PubChem CID 100913786) has the molecular formula C35H38O3 and a molecular weight of 506.69 g/mol. Its IUPAC name is 5-[(5R,6R)-5-ethenyl-6-trityloxyoct-7-en-1-ynyl]-2,2-dimethyl-1,3-dioxane.
| Compound Name | 5-[(5R,6R)-5-ethenyl-6-trityloxyoct-7-en-1-ynyl]-2,2-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 100913786 |
| Molecular Formula | C35H38O3 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 5-[(5R,6R)-5-ethenyl-6-trityloxyoct-7-en-1-ynyl]-2,2-dimethyl-1,3-dioxane |
| SMILES | C=C[C@@H](CCC#CC1COC(C)(C)OC1)[C@@H](C=C)OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H38O3/c1-5-29(19-17-16-18-28-26-36-34(3,4)37-27-28)33(6-2)38-35(30-20-10-7-11-21-30,31-22-12-8-13-23-31)32-24-14-9-15-25-32/h5-15,20-25,28-29,33H,1-2,17,19,26-27H2,3-4H3/t29-,33+/m0/s1 |
| InChIKey | WSTTVWITHLFLEL-RYCFQHDISA-N |
| XLogP | 7.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|