C26H38O2S — CID 100913853
(8S,8aS)-8-[(E)-1-(benzenesulfonyl)-3-methylpent-3-enyl]-4,4,7,8a-tetramethyl-1,2,3,4a,5,8-hexahydronaphthalene (PubChem CID 100913853) has the molecular formula C26H38O2S and a molecular weight of 414.66 g/mol. Its IUPAC name is (8S,8aS)-8-[(E)-1-(benzenesulfonyl)-3-methylpent-3-enyl]-4,4,7,8a-tetramethyl-1,2,3,4a,5,8-hexahydronaphthalene.
| Compound Name | (8S,8aS)-8-[(E)-1-(benzenesulfonyl)-3-methylpent-3-enyl]-4,4,7,8a-tetramethyl-1,2,3,4a,5,8-hexahydronaphthalene |
|---|---|
| PubChem CID | 100913853 |
| Molecular Formula | C26H38O2S |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | (8S,8aS)-8-[(E)-1-(benzenesulfonyl)-3-methylpent-3-enyl]-4,4,7,8a-tetramethyl-1,2,3,4a,5,8-hexahydronaphthalene |
| SMILES | C/C=C(\C)CC([C@H]1C(C)=CCC2C(C)(C)CCC[C@@]21C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H38O2S/c1-7-19(2)18-22(29(27,28)21-12-9-8-10-13-21)24-20(3)14-15-23-25(4,5)16-11-17-26(23,24)6/h7-10,12-14,22-24H,11,15-18H2,1-6H3/b19-7+/t22?,23?,24-,26+/m1/s1 |
| InChIKey | SPICIGPGUMWVIH-MBIMXVANSA-N |
| XLogP | 6.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|