C16H27NO3 — CID 100914044
(Z,2R)-1-[(2R,5R)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-2-prop-2-enylpent-3-en-1-one (PubChem CID 100914044) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is (Z,2R)-1-[(2R,5R)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-2-prop-2-enylpent-3-en-1-one.
| Compound Name | (Z,2R)-1-[(2R,5R)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-2-prop-2-enylpent-3-en-1-one |
|---|---|
| PubChem CID | 100914044 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | (Z,2R)-1-[(2R,5R)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-2-prop-2-enylpent-3-en-1-one |
| SMILES | C=CC[C@H](/C=C\C)C(=O)N1[C@@H](COC)CC[C@@H]1COC |
| InChI | InChI=1S/C16H27NO3/c1-5-7-13(8-6-2)16(18)17-14(11-19-3)9-10-15(17)12-20-4/h5-6,8,13-15H,1,7,9-12H2,2-4H3/b8-6-/t13-,14-,15-/m1/s1 |
| InChIKey | QXGLZXOQXHDXHD-ILUVHHAISA-N |
| XLogP | 2.41 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|