About (3S,5S)-2-benzyl-5-ethoxy-3-phenyl-1,2-oxazolidine
(3S,5S)-2-benzyl-5-ethoxy-3-phenyl-1,2-oxazolidine (PubChem CID 100914315) has the molecular formula C18H21NO2
and a molecular weight of 283.37 g/mol. Its IUPAC name is (3S,5S)-2-benzyl-5-ethoxy-3-phenyl-1,2-oxazolidine.
Molecular Properties
| Compound Name | (3S,5S)-2-benzyl-5-ethoxy-3-phenyl-1,2-oxazolidine |
| PubChem CID | 100914315 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (3S,5S)-2-benzyl-5-ethoxy-3-phenyl-1,2-oxazolidine |
| SMILES | CCO[C@@H]1C[C@@H](c2ccccc2)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C18H21NO2/c1-2-20-18-13-17(16-11-7-4-8-12-16)19(21-18)14-15-9-5-3-6-10-15/h3-12,17-18H,2,13-14H2,1H3/t17-,18-/m0/s1 |
| InChIKey | PJFDRGDLVQUXCQ-ROUUACIJSA-N |
| XLogP | 3.93 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,5S)-2-benzyl-5-ethoxy-3-phenyl-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5S)-2-benzyl-5-ethoxy-3-phenyl-1,2-oxazolidine?
The IUPAC name of (3S,5S)-2-benzyl-5-ethoxy-3-phenyl-1,2-oxazolidine (CID 100914315) is (3S,5S)-2-benzyl-5-ethoxy-3-phenyl-1,2-oxazolidine.
What is the SMILES notation for (3S,5S)-2-benzyl-5-ethoxy-3-phenyl-1,2-oxazolidine?
The canonical SMILES for (3S,5S)-2-benzyl-5-ethoxy-3-phenyl-1,2-oxazolidine is CCO[C@@H]1C[C@@H](c2ccccc2)N(Cc2ccccc2)O1.
What is the InChIKey of (3S,5S)-2-benzyl-5-ethoxy-3-phenyl-1,2-oxazolidine?
The InChIKey is PJFDRGDLVQUXCQ-ROUUACIJSA-N. The full InChI is InChI=1S/C18H21NO2/c1-2-20-18-13-17(16-11-7-4-8-12-16)19(21-18)14-15-9-5-3-6-10-15/h3-12,17-18H,2,13-14H2,1H3/t17-,18-/m0/s1.
What are the key properties of (3S,5S)-2-benzyl-5-ethoxy-3-phenyl-1,2-oxazolidine?
(3S,5S)-2-benzyl-5-ethoxy-3-phenyl-1,2-oxazolidine has a molecular weight of 283.37 g/mol, XLogP of 3.93, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-2-benzyl-5-ethoxy-3-phenyl-1,2-oxazolidine is sourced from PubChem (CID 100914315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).