C25H42O6Si — CID 100914432
ethyl (E)-3-[(2R,5S,6S,9R)-2-tert-butyl-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-1,3-dioxaspiro[4.5]dec-7-en-6-yl]-2-methylprop-2-enoate (PubChem CID 100914432) has the molecular formula C25H42O6Si and a molecular weight of 466.69 g/mol. Its IUPAC name is ethyl (E)-3-[(2R,5S,6S,9R)-2-tert-butyl-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-1,3-dioxaspiro[4.5]dec-7-en-6-yl]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[(2R,5S,6S,9R)-2-tert-butyl-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-1,3-dioxaspiro[4.5]dec-7-en-6-yl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 100914432 |
| Molecular Formula | C25H42O6Si |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | ethyl (E)-3-[(2R,5S,6S,9R)-2-tert-butyl-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-1,3-dioxaspiro[4.5]dec-7-en-6-yl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H]1C=C[C@H](CO[Si](C)(C)C(C)(C)C)C[C@]12O[C@@H](C(C)(C)C)OC2=O |
| InChI | InChI=1S/C25H42O6Si/c1-11-28-20(26)17(2)14-19-13-12-18(16-29-32(9,10)24(6,7)8)15-25(19)21(27)30-22(31-25)23(3,4)5/h12-14,18-19,22H,11,15-16H2,1-10H3/b17-14+/t18-,19-,22-,25-/m0/s1 |
| InChIKey | XUCZGYBQYWPWER-LWCCZREWSA-N |
| XLogP | 5.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|