C14H26O2 — CID 100914447
(1R,2S,4R)-4-tert-butyl-2-methyl-1-prop-2-enylcyclohexane-1,2-diol (PubChem CID 100914447) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is (1R,2S,4R)-4-tert-butyl-2-methyl-1-prop-2-enylcyclohexane-1,2-diol.
| Compound Name | (1R,2S,4R)-4-tert-butyl-2-methyl-1-prop-2-enylcyclohexane-1,2-diol |
|---|---|
| PubChem CID | 100914447 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | (1R,2S,4R)-4-tert-butyl-2-methyl-1-prop-2-enylcyclohexane-1,2-diol |
| SMILES | C=CC[C@]1(O)CC[C@@H](C(C)(C)C)C[C@]1(C)O |
| InChI | InChI=1S/C14H26O2/c1-6-8-14(16)9-7-11(12(2,3)4)10-13(14,5)15/h6,11,15-16H,1,7-10H2,2-5H3/t11-,13+,14+/m1/s1 |
| InChIKey | AAIGGESSFHYALD-XBFCOCLRSA-N |
| XLogP | 2.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|