C8H15F3N2O2 — CID 100914511
(2S)-2-amino-6-(2,2,2-trifluoroethylamino)hexanoic acid (PubChem CID 100914511) has the molecular formula C8H15F3N2O2 and a molecular weight of 228.21 g/mol. Its IUPAC name is (2S)-2-amino-6-(2,2,2-trifluoroethylamino)hexanoic acid.
| Compound Name | (2S)-2-amino-6-(2,2,2-trifluoroethylamino)hexanoic acid |
|---|---|
| PubChem CID | 100914511 |
| Molecular Formula | C8H15F3N2O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (2S)-2-amino-6-(2,2,2-trifluoroethylamino)hexanoic acid |
| SMILES | N[C@@H](CCCCNCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H15F3N2O2/c9-8(10,11)5-13-4-2-1-3-6(12)7(14)15/h6,13H,1-5,12H2,(H,14,15)/t6-/m0/s1 |
| InChIKey | LVTFIBFCPODBTE-LURJTMIESA-N |
| XLogP | 0.72 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|