C17H18F3N3O4 — CID 10091455
1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]imidazolidine-2,4-dione (PubChem CID 10091455) has the molecular formula C17H18F3N3O4 and a molecular weight of 385.34 g/mol. Its IUPAC name is 1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]imidazolidine-2,4-dione.
| Compound Name | 1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10091455 |
| Molecular Formula | C17H18F3N3O4 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]imidazolidine-2,4-dione |
| SMILES | CCCc1c(OCCCN2CC(=O)NC2=O)ccc2c(C(F)(F)F)noc12 |
| InChI | InChI=1S/C17H18F3N3O4/c1-2-4-10-12(26-8-3-7-23-9-13(24)21-16(23)25)6-5-11-14(10)27-22-15(11)17(18,19)20/h5-6H,2-4,7-9H2,1H3,(H,21,24,25) |
| InChIKey | ADAUMTKXPKVYLB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|