C27H47N — CID 10091507
(4e,8e,12e,16e)-4,8,13,17,21-Penta-methyl-4,8,12,16,20-docosapentaenylamine (PubChem CID 10091507) has the molecular formula C27H47N and a molecular weight of 385.70 g/mol. Its IUPAC name is (4E,8E,12E,16E)-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaen-1-amine.
| Compound Name | (4e,8e,12e,16e)-4,8,13,17,21-Penta-methyl-4,8,12,16,20-docosapentaenylamine |
|---|---|
| PubChem CID | 10091507 |
| Molecular Formula | C27H47N |
| Molecular Weight | 385.70 g/mol |
| Exact Mass | 385.37 |
| IUPAC Name | (4E,8E,12E,16E)-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaen-1-amine |
| SMILES | CC(=CCC/C(=C/CC/C(=C/CC/C=C(\C)/CC/C=C(\C)/CCCN)/C)/C)C |
| InChI | InChI=1S/C27H47N/c1-23(2)13-9-16-26(5)19-10-17-24(3)14-7-8-15-25(4)18-11-20-27(6)21-12-22-28/h13-15,19-20H,7-12,16-18,21-22,28H2,1-6H3/b24-14+,25-15+,26-19+,27-20+ |
| InChIKey | HXKCSQYTFJVBEN-OGDZRKEVSA-N |
| XLogP | 9.00 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | 551 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.70 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|