C19H26O5 — CID 100915087
(1R,7S)-10-(5,5-dimethyl-1,3-dioxan-2-yl)-9,9-dimethoxytricyclo[5.2.2.02,6]undeca-4,10-dien-8-one (PubChem CID 100915087) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is (1R,7S)-10-(5,5-dimethyl-1,3-dioxan-2-yl)-9,9-dimethoxytricyclo[5.2.2.02,6]undeca-4,10-dien-8-one.
| Compound Name | (1R,7S)-10-(5,5-dimethyl-1,3-dioxan-2-yl)-9,9-dimethoxytricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
|---|---|
| PubChem CID | 100915087 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (1R,7S)-10-(5,5-dimethyl-1,3-dioxan-2-yl)-9,9-dimethoxytricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
| SMILES | COC1(OC)C(=O)[C@@H]2C=C(C3OCC(C)(C)CO3)[C@H]1C1CC=CC12 |
| InChI | InChI=1S/C19H26O5/c1-18(2)9-23-17(24-10-18)14-8-13-11-6-5-7-12(11)15(14)19(21-3,22-4)16(13)20/h5-6,8,11-13,15,17H,7,9-10H2,1-4H3/t11?,12?,13-,15-/m1/s1 |
| InChIKey | QFVGTUWOWWDXAH-UJFKTDLFSA-N |
| XLogP | 2.32 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|