C13H14O7 — CID 100915139
4,5,6,8-tetramethoxy-4H-isochromene-1,3-dione (PubChem CID 100915139) has the molecular formula C13H14O7 and a molecular weight of 282.25 g/mol. Its IUPAC name is 4,5,6,8-tetramethoxy-4H-isochromene-1,3-dione.
| Compound Name | 4,5,6,8-tetramethoxy-4H-isochromene-1,3-dione |
|---|---|
| PubChem CID | 100915139 |
| Molecular Formula | C13H14O7 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 4,5,6,8-tetramethoxy-4H-isochromene-1,3-dione |
| SMILES | COc1cc(OC)c2c(c1OC)C(OC)C(=O)OC2=O |
| InChI | InChI=1S/C13H14O7/c1-16-6-5-7(17-2)10(18-3)9-8(6)12(14)20-13(15)11(9)19-4/h5,11H,1-4H3 |
| InChIKey | LYYAOMCKYZULCI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|