C6H8N4OS2 — CID 100915183
1-[[4,6-bis(sulfanylidene)-1H-1,3,5-triazin-2-yl]amino]propan-2-one (PubChem CID 100915183) has the molecular formula C6H8N4OS2 and a molecular weight of 216.29 g/mol. Its IUPAC name is 1-[[4,6-bis(sulfanylidene)-1H-1,3,5-triazin-2-yl]amino]propan-2-one.
| Compound Name | 1-[[4,6-bis(sulfanylidene)-1H-1,3,5-triazin-2-yl]amino]propan-2-one |
|---|---|
| PubChem CID | 100915183 |
| Molecular Formula | C6H8N4OS2 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 1-[[4,6-bis(sulfanylidene)-1H-1,3,5-triazin-2-yl]amino]propan-2-one |
| SMILES | CC(=O)CNc1nc(=S)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C6H8N4OS2/c1-3(11)2-7-4-8-5(12)10-6(13)9-4/h2H2,1H3,(H3,7,8,9,10,12,13) |
| InChIKey | FYBMUWQTGUSDMD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|