C32H44O2SSi — CID 100915208
(2E,4aR,6S,8aS)-6-[tert-butyl(diphenyl)silyl]oxy-2-(butylsulfanylmethylidene)-8a-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one (PubChem CID 100915208) has the molecular formula C32H44O2SSi and a molecular weight of 520.86 g/mol. Its IUPAC name is (2E,4aR,6S,8aS)-6-[tert-butyl(diphenyl)silyl]oxy-2-(butylsulfanylmethylidene)-8a-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one.
| Compound Name | (2E,4aR,6S,8aS)-6-[tert-butyl(diphenyl)silyl]oxy-2-(butylsulfanylmethylidene)-8a-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one |
|---|---|
| PubChem CID | 100915208 |
| Molecular Formula | C32H44O2SSi |
| Molecular Weight | 520.86 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | (2E,4aR,6S,8aS)-6-[tert-butyl(diphenyl)silyl]oxy-2-(butylsulfanylmethylidene)-8a-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one |
| SMILES | CCCCS/C=C1\CC[C@@H]2C[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC[C@]2(C)C1=O |
| InChI | InChI=1S/C32H44O2SSi/c1-6-7-22-35-24-25-18-19-26-23-27(20-21-32(26,5)30(25)33)34-36(31(2,3)4,28-14-10-8-11-15-28)29-16-12-9-13-17-29/h8-17,24,26-27H,6-7,18-23H2,1-5H3/b25-24+/t26-,27+,32+/m1/s1 |
| InChIKey | CSUYQHSCDZQRKX-UWXNBLNMSA-N |
| XLogP | 7.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.86 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|