About N-cyclopenta-1,3-dien-1-yl-1-pyridin-4-ylmethanimine
N-cyclopenta-1,3-dien-1-yl-1-pyridin-4-ylmethanimine (PubChem CID 100916171) has the molecular formula C11H10N2
and a molecular weight of 170.21 g/mol. Its IUPAC name is N-cyclopenta-1,3-dien-1-yl-1-pyridin-4-ylmethanimine.
Molecular Properties
| Compound Name | N-cyclopenta-1,3-dien-1-yl-1-pyridin-4-ylmethanimine |
| PubChem CID | 100916171 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | N-cyclopenta-1,3-dien-1-yl-1-pyridin-4-ylmethanimine |
| SMILES | C1=CCC(/N=C/c2ccncc2)=C1 |
| InChI | InChI=1S/C11H10N2/c1-2-4-11(3-1)13-9-10-5-7-12-8-6-10/h1-3,5-9H,4H2/b13-9+ |
| InChIKey | NPSTWLHGLRIZLB-UKTHLTGXSA-N |
| XLogP | 2.34 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopenta-1,3-dien-1-yl-1-pyridin-4-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopenta-1,3-dien-1-yl-1-pyridin-4-ylmethanimine?
The IUPAC name of N-cyclopenta-1,3-dien-1-yl-1-pyridin-4-ylmethanimine (CID 100916171) is N-cyclopenta-1,3-dien-1-yl-1-pyridin-4-ylmethanimine.
What is the SMILES notation for N-cyclopenta-1,3-dien-1-yl-1-pyridin-4-ylmethanimine?
The canonical SMILES for N-cyclopenta-1,3-dien-1-yl-1-pyridin-4-ylmethanimine is C1=CCC(/N=C/c2ccncc2)=C1.
What is the InChIKey of N-cyclopenta-1,3-dien-1-yl-1-pyridin-4-ylmethanimine?
The InChIKey is NPSTWLHGLRIZLB-UKTHLTGXSA-N. The full InChI is InChI=1S/C11H10N2/c1-2-4-11(3-1)13-9-10-5-7-12-8-6-10/h1-3,5-9H,4H2/b13-9+.
What are the key properties of N-cyclopenta-1,3-dien-1-yl-1-pyridin-4-ylmethanimine?
N-cyclopenta-1,3-dien-1-yl-1-pyridin-4-ylmethanimine has a molecular weight of 170.21 g/mol, XLogP of 2.34, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopenta-1,3-dien-1-yl-1-pyridin-4-ylmethanimine is sourced from PubChem (CID 100916171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).