About 4-[[3,5-dichloro-2-fluoro-6-(1-hydroxypropan-2-ylamino)-4-pyridinyl]oxy]-2-propan-2-ylphenol
4-[[3,5-dichloro-2-fluoro-6-(1-hydroxypropan-2-ylamino)-4-pyridinyl]oxy]-2-propan-2-ylphenol (PubChem CID 10091706) has the molecular formula C17H19Cl2FN2O3
and a molecular weight of 389.25 g/mol. Its IUPAC name is 4-[[3,5-dichloro-2-fluoro-6-(1-hydroxypropan-2-ylamino)-4-pyridinyl]oxy]-2-propan-2-ylphenol.
Molecular Properties
| Compound Name | 4-[[3,5-dichloro-2-fluoro-6-(1-hydroxypropan-2-ylamino)-4-pyridinyl]oxy]-2-propan-2-ylphenol |
| PubChem CID | 10091706 |
| Molecular Formula | C17H19Cl2FN2O3 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 4-[[3,5-dichloro-2-fluoro-6-(1-hydroxypropan-2-ylamino)-4-pyridinyl]oxy]-2-propan-2-ylphenol |
| SMILES | CC(CO)Nc1nc(F)c(Cl)c(Oc2ccc(O)c(C(C)C)c2)c1Cl |
| InChI | InChI=1S/C17H19Cl2FN2O3/c1-8(2)11-6-10(4-5-12(11)24)25-15-13(18)16(20)22-17(14(15)19)21-9(3)7-23/h4-6,8-9,23-24H,7H2,1-3H3,(H,21,22) |
| InChIKey | SRPXOOPLRQSWAR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-[[3,5-dichloro-2-fluoro-6-(1-hydroxypropan-2-ylamino)-4-pyridinyl]oxy]-2-propan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3,5-dichloro-2-fluoro-6-(1-hydroxypropan-2-ylamino)-4-pyridinyl]oxy]-2-propan-2-ylphenol?
The IUPAC name of 4-[[3,5-dichloro-2-fluoro-6-(1-hydroxypropan-2-ylamino)-4-pyridinyl]oxy]-2-propan-2-ylphenol (CID 10091706) is 4-[[3,5-dichloro-2-fluoro-6-(1-hydroxypropan-2-ylamino)-4-pyridinyl]oxy]-2-propan-2-ylphenol.
What is the SMILES notation for 4-[[3,5-dichloro-2-fluoro-6-(1-hydroxypropan-2-ylamino)-4-pyridinyl]oxy]-2-propan-2-ylphenol?
The canonical SMILES for 4-[[3,5-dichloro-2-fluoro-6-(1-hydroxypropan-2-ylamino)-4-pyridinyl]oxy]-2-propan-2-ylphenol is CC(CO)Nc1nc(F)c(Cl)c(Oc2ccc(O)c(C(C)C)c2)c1Cl.
What is the InChIKey of 4-[[3,5-dichloro-2-fluoro-6-(1-hydroxypropan-2-ylamino)-4-pyridinyl]oxy]-2-propan-2-ylphenol?
The InChIKey is SRPXOOPLRQSWAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19Cl2FN2O3/c1-8(2)11-6-10(4-5-12(11)24)25-15-13(18)16(20)22-17(14(15)19)21-9(3)7-23/h4-6,8-9,23-24H,7H2,1-3H3,(H,21,22).
What are the key properties of 4-[[3,5-dichloro-2-fluoro-6-(1-hydroxypropan-2-ylamino)-4-pyridinyl]oxy]-2-propan-2-ylphenol?
4-[[3,5-dichloro-2-fluoro-6-(1-hydroxypropan-2-ylamino)-4-pyridinyl]oxy]-2-propan-2-ylphenol has a molecular weight of 389.25 g/mol, XLogP of 4.94, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3,5-dichloro-2-fluoro-6-(1-hydroxypropan-2-ylamino)-4-pyridinyl]oxy]-2-propan-2-ylphenol is sourced from PubChem (CID 10091706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).