C23H44N2O2+2 — CID 100917110
(1S,5R)-8-[7-[(1R,5S)-3-hydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-8-yl]heptyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol (PubChem CID 100917110) has the molecular formula C23H44N2O2+2 and a molecular weight of 380.62 g/mol. Its IUPAC name is (1S,5R)-8-[7-[(1R,5S)-3-hydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-8-yl]heptyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1S,5R)-8-[7-[(1R,5S)-3-hydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-8-yl]heptyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 100917110 |
| Molecular Formula | C23H44N2O2+2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.34 |
| IUPAC Name | (1S,5R)-8-[7-[(1R,5S)-3-hydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-8-yl]heptyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol |
| SMILES | C[N+]1(CCCCCCC[N+]2(C)[C@@H]3CC[C@H]2CC(O)C3)[C@@H]2CC[C@H]1CC(O)C2 |
| InChI | InChI=1S/C23H44N2O2/c1-24(18-8-9-19(24)15-22(26)14-18)12-6-4-3-5-7-13-25(2)20-10-11-21(25)17-23(27)16-20/h18-23,26-27H,3-17H2,1-2H3/q+2/t18-,19+,20-,21+,22?,23?,24?,25? |
| InChIKey | SRACKAUPQVJQDR-KLYNJNFFSA-N |
| XLogP | 3.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|