C24H46N2O2+2 — CID 100917111
(1S,5R)-8-[8-[(1S,5R)-3-hydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-8-yl]octyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol (PubChem CID 100917111) has the molecular formula C24H46N2O2+2 and a molecular weight of 394.64 g/mol. Its IUPAC name is (1S,5R)-8-[8-[(1S,5R)-3-hydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-8-yl]octyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1S,5R)-8-[8-[(1S,5R)-3-hydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-8-yl]octyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 100917111 |
| Molecular Formula | C24H46N2O2+2 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.35 |
| IUPAC Name | (1S,5R)-8-[8-[(1S,5R)-3-hydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-8-yl]octyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol |
| SMILES | C[N+]1(CCCCCCCC[N+]2(C)[C@@H]3CC[C@H]2CC(O)C3)[C@@H]2CC[C@H]1CC(O)C2 |
| InChI | InChI=1S/C24H46N2O2/c1-25(19-9-10-20(25)16-23(27)15-19)13-7-5-3-4-6-8-14-26(2)21-11-12-22(26)18-24(28)17-21/h19-24,27-28H,3-18H2,1-2H3/q+2/t19-,20+,21-,22+,23?,24?,25?,26? |
| InChIKey | SLVGPJLZKSMYGV-IIFVFRNJSA-N |
| XLogP | 3.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|