C18H28O3 — CID 100917586
(3R,4E,6E)-5-ethyl-3-methyl-7-[(2R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hepta-4,6-dienal (PubChem CID 100917586) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (3R,4E,6E)-5-ethyl-3-methyl-7-[(2R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hepta-4,6-dienal.
| Compound Name | (3R,4E,6E)-5-ethyl-3-methyl-7-[(2R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hepta-4,6-dienal |
|---|---|
| PubChem CID | 100917586 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (3R,4E,6E)-5-ethyl-3-methyl-7-[(2R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hepta-4,6-dienal |
| SMILES | CCC(/C=C/[C@H]1CC=CC(OC(C)C)O1)=C\[C@H](C)CC=O |
| InChI | InChI=1S/C18H28O3/c1-5-16(13-15(4)11-12-19)9-10-17-7-6-8-18(21-17)20-14(2)3/h6,8-10,12-15,17-18H,5,7,11H2,1-4H3/b10-9+,16-13+/t15-,17-,18?/m1/s1 |
| InChIKey | ZUYPWGLCQNXUTH-QGVYWOMBSA-N |
| XLogP | 4.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|