C13H25N3O2Si — CID 100917756
[(3aS,5R,6R,7aR)-6-azido-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran-5-yl]oxy-dimethyl-propan-2-ylsilane (PubChem CID 100917756) has the molecular formula C13H25N3O2Si and a molecular weight of 283.45 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-6-azido-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran-5-yl]oxy-dimethyl-propan-2-ylsilane.
| Compound Name | [(3aS,5R,6R,7aR)-6-azido-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran-5-yl]oxy-dimethyl-propan-2-ylsilane |
|---|---|
| PubChem CID | 100917756 |
| Molecular Formula | C13H25N3O2Si |
| Molecular Weight | 283.45 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | [(3aS,5R,6R,7aR)-6-azido-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran-5-yl]oxy-dimethyl-propan-2-ylsilane |
| SMILES | CC(C)[Si](C)(C)O[C@@H]1C[C@@H]2COC[C@@H]2C[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C13H25N3O2Si/c1-9(2)19(3,4)18-13-6-11-8-17-7-10(11)5-12(13)15-16-14/h9-13H,5-8H2,1-4H3/t10-,11+,12+,13+/m0/s1 |
| InChIKey | FFOVHMDUXMVCQU-UMSGYPCISA-N |
| XLogP | 3.72 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|