C13H19N5O4S — CID 100917989
6-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfonylamino]hexanoic acid (PubChem CID 100917989) has the molecular formula C13H19N5O4S and a molecular weight of 341.39 g/mol. Its IUPAC name is 6-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfonylamino]hexanoic acid.
| Compound Name | 6-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 100917989 |
| Molecular Formula | C13H19N5O4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 6-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfonylamino]hexanoic acid |
| SMILES | Cc1cc(C)n2nc(S(=O)(=O)NCCCCCC(=O)O)nc2n1 |
| InChI | InChI=1S/C13H19N5O4S/c1-9-8-10(2)18-12(15-9)16-13(17-18)23(21,22)14-7-5-3-4-6-11(19)20/h8,14H,3-7H2,1-2H3,(H,19,20) |
| InChIKey | NJAZPVYDAXPPQI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 126.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|