C26H24Br2N2O — CID 100918659
2-[4-[2,5-bis(bromomethyl)phenyl]phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole (PubChem CID 100918659) has the molecular formula C26H24Br2N2O and a molecular weight of 540.30 g/mol. Its IUPAC name is 2-[4-[2,5-bis(bromomethyl)phenyl]phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[4-[2,5-bis(bromomethyl)phenyl]phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 100918659 |
| Molecular Formula | C26H24Br2N2O |
| Molecular Weight | 540.30 g/mol |
| Exact Mass | 538.03 |
| IUPAC Name | 2-[4-[2,5-bis(bromomethyl)phenyl]phenyl]-5-(4-tert-butylphenyl)-1,3,4-oxadiazole |
| SMILES | CC(C)(C)c1ccc(-c2nnc(-c3ccc(-c4cc(CBr)ccc4CBr)cc3)o2)cc1 |
| InChI | InChI=1S/C26H24Br2N2O/c1-26(2,3)22-12-10-20(11-13-22)25-30-29-24(31-25)19-8-6-18(7-9-19)23-14-17(15-27)4-5-21(23)16-28/h4-14H,15-16H2,1-3H3 |
| InChIKey | NLMFUZBHIMVWLC-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.30 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|