C20H24O8 — CID 10091899
(1S,2S,4S,5S,7R,8R,9S,11S,12S,13R)-8,12,13-trihydroxy-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one (PubChem CID 10091899) has the molecular formula C20H24O8 and a molecular weight of 392.40 g/mol. Its IUPAC name is (1S,2S,4S,5S,7R,8R,9S,11S,12S,13R)-8,12,13-trihydroxy-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one.
| Compound Name | (1S,2S,4S,5S,7R,8R,9S,11S,12S,13R)-8,12,13-trihydroxy-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one |
|---|---|
| PubChem CID | 10091899 |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (1S,2S,4S,5S,7R,8R,9S,11S,12S,13R)-8,12,13-trihydroxy-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one |
| SMILES | CC(C)[C@]12O[C@H]1[C@@H]1O[C@]13[C@]1(O[C@H]1[C@H](O)[C@@]1(O)C4=C(CC[C@]31C)C(=O)OC4)[C@@H]2O |
| InChI | InChI=1S/C20H24O8/c1-7(2)17-12(26-17)13-20(28-13)16(3)5-4-8-9(6-25-14(8)22)18(16,24)10(21)11-19(20,27-11)15(17)23/h7,10-13,15,21,23-24H,4-6H2,1-3H3/t10-,11-,12-,13-,15+,16-,17-,18-,19+,20+/m0/s1 |
| InChIKey | YCJUIWPDUYMFHW-KSRKSBGQSA-N |
| XLogP | -0.81 |
| TPSA | 124.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|