C32H44O2 — CID 100919357
(1R)-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-19-hydroxy-3,7,12,16-tetramethylnonadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol (PubChem CID 100919357) has the molecular formula C32H44O2 and a molecular weight of 460.70 g/mol. Its IUPAC name is (1R)-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-19-hydroxy-3,7,12,16-tetramethylnonadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol.
| Compound Name | (1R)-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-19-hydroxy-3,7,12,16-tetramethylnonadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 100919357 |
| Molecular Formula | C32H44O2 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.33 |
| IUPAC Name | (1R)-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-19-hydroxy-3,7,12,16-tetramethylnonadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/CO)C(C)(C)C[C@H](O)C1 |
| InChI | InChI=1S/C32H44O2/c1-25(15-10-17-27(3)19-12-22-33)13-8-9-14-26(2)16-11-18-28(4)20-21-31-29(5)23-30(34)24-32(31,6)7/h8-21,30,33-34H,22-24H2,1-7H3/b9-8+,15-10+,16-11+,19-12+,21-20+,25-13+,26-14+,27-17+,28-18+/t30-/m1/s1 |
| InChIKey | UKMDUGPSKIYGBX-MPWWCMQKSA-N |
| XLogP | 8.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|