C21H28NO+ — CID 100919745
[(S)-[(1S,2R)-1-hydroxy-1-methyl-3,4-dihydro-2H-naphthalen-2-yl]-phenylmethyl]-trimethylazanium (PubChem CID 100919745) has the molecular formula C21H28NO+ and a molecular weight of 310.46 g/mol. Its IUPAC name is [(S)-[(1S,2R)-1-hydroxy-1-methyl-3,4-dihydro-2H-naphthalen-2-yl]-phenylmethyl]-trimethylazanium.
| Compound Name | [(S)-[(1S,2R)-1-hydroxy-1-methyl-3,4-dihydro-2H-naphthalen-2-yl]-phenylmethyl]-trimethylazanium |
|---|---|
| PubChem CID | 100919745 |
| Molecular Formula | C21H28NO+ |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | [(S)-[(1S,2R)-1-hydroxy-1-methyl-3,4-dihydro-2H-naphthalen-2-yl]-phenylmethyl]-trimethylazanium |
| SMILES | C[C@@]1(O)c2ccccc2CC[C@@H]1[C@@H](c1ccccc1)[N+](C)(C)C |
| InChI | InChI=1S/C21H28NO/c1-21(23)18-13-9-8-10-16(18)14-15-19(21)20(22(2,3)4)17-11-6-5-7-12-17/h5-13,19-20,23H,14-15H2,1-4H3/q+1/t19-,20-,21-/m1/s1 |
| InChIKey | SQUPEFIXQCWOBK-NJDAHSKKSA-N |
| XLogP | 3.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|