C26H29NO3 — CID 100919774
(3S,6S)-3,6-dimethyl-4-[(1S)-1-phenylethyl]-3-[(E)-3-phenylprop-2-enyl]-6-prop-2-enylmorpholine-2,5-dione (PubChem CID 100919774) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is (3S,6S)-3,6-dimethyl-4-[(1S)-1-phenylethyl]-3-[(E)-3-phenylprop-2-enyl]-6-prop-2-enylmorpholine-2,5-dione.
| Compound Name | (3S,6S)-3,6-dimethyl-4-[(1S)-1-phenylethyl]-3-[(E)-3-phenylprop-2-enyl]-6-prop-2-enylmorpholine-2,5-dione |
|---|---|
| PubChem CID | 100919774 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (3S,6S)-3,6-dimethyl-4-[(1S)-1-phenylethyl]-3-[(E)-3-phenylprop-2-enyl]-6-prop-2-enylmorpholine-2,5-dione |
| SMILES | C=CC[C@]1(C)OC(=O)[C@](C)(C/C=C/c2ccccc2)N([C@@H](C)c2ccccc2)C1=O |
| InChI | InChI=1S/C26H29NO3/c1-5-18-26(4)23(28)27(20(2)22-16-10-7-11-17-22)25(3,24(29)30-26)19-12-15-21-13-8-6-9-14-21/h5-17,20H,1,18-19H2,2-4H3/b15-12+/t20-,25-,26-/m0/s1 |
| InChIKey | HGYQYCXKQWDYKX-WYHMGXLXSA-N |
| XLogP | 5.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|