About CID 100919819
CID 100919819 (PubChem CID 100919819) has the molecular formula C17H39OSi4
and a molecular weight of 371.84 g/mol.
Molecular Properties
| Compound Name | CID 100919819 |
| PubChem CID | 100919819 |
| Molecular Formula | C17H39OSi4 |
| Molecular Weight | 371.84 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC([O])=CC1[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C17H39OSi4/c1-17(2)13-12-15(18)14-16(17)22(19(3,4)5,20(6,7)8)21(9,10)11/h14,16H,12-13H2,1-11H3 |
| InChIKey | CKWIQJJHOORGPG-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 19.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.84 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 100919819 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 100919819?
The IUPAC name of CID 100919819 (CID 100919819) is not available.
What is the SMILES notation for CID 100919819?
The canonical SMILES for CID 100919819 is CC1(C)CCC([O])=CC1[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of CID 100919819?
The InChIKey is CKWIQJJHOORGPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H39OSi4/c1-17(2)13-12-15(18)14-16(17)22(19(3,4)5,20(6,7)8)21(9,10)11/h14,16H,12-13H2,1-11H3.
What are the key properties of CID 100919819?
CID 100919819 has a molecular weight of 371.84 g/mol, XLogP of 6.19, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 100919819 is sourced from PubChem (CID 100919819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).