C33H41NO9 — CID 100919825
(9S)-6,8,11-trihydroxy-7-[(2S,4S,5S,6S)-5-hydroxy-6-methyl-4-morpholin-4-yloxan-2-yl]oxy-9-pentyl-7,8,9,10-tetrahydrotetracene-5,12-dione (PubChem CID 100919825) has the molecular formula C33H41NO9 and a molecular weight of 595.69 g/mol. Its IUPAC name is (9S)-6,8,11-trihydroxy-7-[(2S,4S,5S,6S)-5-hydroxy-6-methyl-4-morpholin-4-yloxan-2-yl]oxy-9-pentyl-7,8,9,10-tetrahydrotetracene-5,12-dione.
| Compound Name | (9S)-6,8,11-trihydroxy-7-[(2S,4S,5S,6S)-5-hydroxy-6-methyl-4-morpholin-4-yloxan-2-yl]oxy-9-pentyl-7,8,9,10-tetrahydrotetracene-5,12-dione |
|---|---|
| PubChem CID | 100919825 |
| Molecular Formula | C33H41NO9 |
| Molecular Weight | 595.69 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | (9S)-6,8,11-trihydroxy-7-[(2S,4S,5S,6S)-5-hydroxy-6-methyl-4-morpholin-4-yloxan-2-yl]oxy-9-pentyl-7,8,9,10-tetrahydrotetracene-5,12-dione |
| SMILES | CCCCC[C@H]1Cc2c(O)c3c(c(O)c2C(O[C@H]2C[C@H](N4CCOCC4)[C@H](O)[C@H](C)O2)C1O)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C33H41NO9/c1-3-4-5-8-18-15-21-24(32(40)26-25(31(21)39)29(37)19-9-6-7-10-20(19)30(26)38)33(28(18)36)43-23-16-22(27(35)17(2)42-23)34-11-13-41-14-12-34/h6-7,9-10,17-18,22-23,27-28,33,35-36,39-40H,3-5,8,11-16H2,1-2H3/t17-,18-,22-,23-,27+,28?,33?/m0/s1 |
| InChIKey | RUJPKZJBGLSZSN-WVGLOMJHSA-N |
| XLogP | 3.24 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.69 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|