About [1-cyclohexyl-2-hydroxy-2-(4-methylphenyl)ethyl] N,N-diethylcarbamate
[1-cyclohexyl-2-hydroxy-2-(4-methylphenyl)ethyl] N,N-diethylcarbamate (PubChem CID 100919842) has the molecular formula C20H31NO3
and a molecular weight of 333.47 g/mol. Its IUPAC name is [1-cyclohexyl-2-hydroxy-2-(4-methylphenyl)ethyl] N,N-diethylcarbamate.
Molecular Properties
| Compound Name | [1-cyclohexyl-2-hydroxy-2-(4-methylphenyl)ethyl] N,N-diethylcarbamate |
| PubChem CID | 100919842 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | [1-cyclohexyl-2-hydroxy-2-(4-methylphenyl)ethyl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OC(C1CCCCC1)C(O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H31NO3/c1-4-21(5-2)20(23)24-19(17-9-7-6-8-10-17)18(22)16-13-11-15(3)12-14-16/h11-14,17-19,22H,4-10H2,1-3H3 |
| InChIKey | QCSQFFILNOADJT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-cyclohexyl-2-hydroxy-2-(4-methylphenyl)ethyl] N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-cyclohexyl-2-hydroxy-2-(4-methylphenyl)ethyl] N,N-diethylcarbamate?
The IUPAC name of [1-cyclohexyl-2-hydroxy-2-(4-methylphenyl)ethyl] N,N-diethylcarbamate (CID 100919842) is [1-cyclohexyl-2-hydroxy-2-(4-methylphenyl)ethyl] N,N-diethylcarbamate.
What is the SMILES notation for [1-cyclohexyl-2-hydroxy-2-(4-methylphenyl)ethyl] N,N-diethylcarbamate?
The canonical SMILES for [1-cyclohexyl-2-hydroxy-2-(4-methylphenyl)ethyl] N,N-diethylcarbamate is CCN(CC)C(=O)OC(C1CCCCC1)C(O)c1ccc(C)cc1.
What is the InChIKey of [1-cyclohexyl-2-hydroxy-2-(4-methylphenyl)ethyl] N,N-diethylcarbamate?
The InChIKey is QCSQFFILNOADJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31NO3/c1-4-21(5-2)20(23)24-19(17-9-7-6-8-10-17)18(22)16-13-11-15(3)12-14-16/h11-14,17-19,22H,4-10H2,1-3H3.
What are the key properties of [1-cyclohexyl-2-hydroxy-2-(4-methylphenyl)ethyl] N,N-diethylcarbamate?
[1-cyclohexyl-2-hydroxy-2-(4-methylphenyl)ethyl] N,N-diethylcarbamate has a molecular weight of 333.47 g/mol, XLogP of 4.46, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-cyclohexyl-2-hydroxy-2-(4-methylphenyl)ethyl] N,N-diethylcarbamate is sourced from PubChem (CID 100919842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).