C23H38BCl — CID 100920086
[(Z)-3-chloroprop-2-enyl]-bis[(1S,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane (PubChem CID 100920086) has the molecular formula C23H38BCl and a molecular weight of 360.82 g/mol. Its IUPAC name is [(Z)-3-chloroprop-2-enyl]-bis[(1S,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane.
| Compound Name | [(Z)-3-chloroprop-2-enyl]-bis[(1S,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
|---|---|
| PubChem CID | 100920086 |
| Molecular Formula | C23H38BCl |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | [(Z)-3-chloroprop-2-enyl]-bis[(1S,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
| SMILES | C[C@@H]1[C@@H](B(C/C=C\Cl)[C@H]2C[C@@H]3C[C@@H]([C@@H]2C)C3(C)C)C[C@@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C23H38BCl/c1-14-18-10-16(22(18,3)4)12-20(14)24(8-7-9-25)21-13-17-11-19(15(21)2)23(17,5)6/h7,9,14-21H,8,10-13H2,1-6H3/b9-7-/t14-,15-,16-,17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | SMCIOXKEBYLVNZ-CWQGKCMFSA-N |
| XLogP | 7.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|