C9H17O10S- — CID 100920818
[(2S,3S,4S,5R,6S)-6-[(2R)-2,3-dihydroxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonate (PubChem CID 100920818) has the molecular formula C9H17O10S- and a molecular weight of 317.29 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-6-[(2R)-2,3-dihydroxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonate.
| Compound Name | [(2S,3S,4S,5R,6S)-6-[(2R)-2,3-dihydroxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonate |
|---|---|
| PubChem CID | 100920818 |
| Molecular Formula | C9H17O10S- |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-6-[(2R)-2,3-dihydroxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonate |
| SMILES | O=S(=O)([O-])C[C@H]1O[C@H](OC[C@H](O)CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H18O10S/c10-1-4(11)2-18-9-8(14)7(13)6(12)5(19-9)3-20(15,16)17/h4-14H,1-3H2,(H,15,16,17)/p-1/t4-,5-,6-,7+,8-,9+/m1/s1 |
| InChIKey | JTXHNMDHGMNPEG-NZJLWHDDSA-M |
| XLogP | -4.29 |
| TPSA | 176.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | -4.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|