C25H20N2O3 — CID 10092139
3-(1-methylindol-3-yl)-4-(6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)furan-2,5-dione (PubChem CID 10092139) has the molecular formula C25H20N2O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-(1-methylindol-3-yl)-4-(6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)furan-2,5-dione.
| Compound Name | 3-(1-methylindol-3-yl)-4-(6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)furan-2,5-dione |
|---|---|
| PubChem CID | 10092139 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 3-(1-methylindol-3-yl)-4-(6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)furan-2,5-dione |
| SMILES | Cn1cc(C2=C(c3c4n(c5ccccc35)CCCC4)C(=O)OC2=O)c2ccccc21 |
| InChI | InChI=1S/C25H20N2O3/c1-26-14-17(15-8-2-4-10-18(15)26)22-23(25(29)30-24(22)28)21-16-9-3-5-11-19(16)27-13-7-6-12-20(21)27/h2-5,8-11,14H,6-7,12-13H2,1H3 |
| InChIKey | LZGZDJLHUOSEJY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|