C21H32O7 — CID 10092151
(1S,2S,3R,7R,9E,11E,14R,16R)-3-hydroxy-2,18-dimethoxy-7,14-dimethyl-6,19-dioxabicyclo[14.3.0]nonadeca-9,11-diene-5,13-dione (PubChem CID 10092151) has the molecular formula C21H32O7 and a molecular weight of 396.48 g/mol. Its IUPAC name is (1S,2S,3R,7R,9E,11E,14R,16R)-3-hydroxy-2,18-dimethoxy-7,14-dimethyl-6,19-dioxabicyclo[14.3.0]nonadeca-9,11-diene-5,13-dione.
| Compound Name | (1S,2S,3R,7R,9E,11E,14R,16R)-3-hydroxy-2,18-dimethoxy-7,14-dimethyl-6,19-dioxabicyclo[14.3.0]nonadeca-9,11-diene-5,13-dione |
|---|---|
| PubChem CID | 10092151 |
| Molecular Formula | C21H32O7 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | (1S,2S,3R,7R,9E,11E,14R,16R)-3-hydroxy-2,18-dimethoxy-7,14-dimethyl-6,19-dioxabicyclo[14.3.0]nonadeca-9,11-diene-5,13-dione |
| SMILES | COC1C[C@H]2C[C@@H](C)C(=O)/C=C/C=C/C[C@@H](C)OC(=O)C[C@@H](O)[C@H](OC)[C@H]2O1 |
| InChI | InChI=1S/C21H32O7/c1-13-10-15-11-19(25-3)28-20(15)21(26-4)17(23)12-18(24)27-14(2)8-6-5-7-9-16(13)22/h5-7,9,13-15,17,19-21,23H,8,10-12H2,1-4H3/b6-5+,9-7+/t13-,14-,15-,17-,19?,20+,21+/m1/s1 |
| InChIKey | YPABMQWZXCVWTI-ZTUCCLMESA-N |
| XLogP | 2.17 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |