About 1a,7b-dideuteriooxireno[2,3-f]quinoline
1a,7b-dideuteriooxireno[2,3-f]quinoline (PubChem CID 100921913) has the molecular formula C9H7NO
and a molecular weight of 147.17 g/mol. Its IUPAC name is 1a,7b-dideuteriooxireno[2,3-f]quinoline.
Molecular Properties
| Compound Name | 1a,7b-dideuteriooxireno[2,3-f]quinoline |
| PubChem CID | 100921913 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 1a,7b-dideuteriooxireno[2,3-f]quinoline |
| SMILES | [2H]C12C=Cc3ncccc3C1([2H])O2 |
| InChI | InChI=1S/C9H7NO/c1-2-6-7(10-5-1)3-4-8-9(6)11-8/h1-5,8-9H/i8D,9D |
| InChIKey | DUTMSHWTRSUNIF-XETGXLELSA-N |
| XLogP | 1.55 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1a,7b-dideuteriooxireno[2,3-f]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1a,7b-dideuteriooxireno[2,3-f]quinoline?
The IUPAC name of 1a,7b-dideuteriooxireno[2,3-f]quinoline (CID 100921913) is 1a,7b-dideuteriooxireno[2,3-f]quinoline.
What is the SMILES notation for 1a,7b-dideuteriooxireno[2,3-f]quinoline?
The canonical SMILES for 1a,7b-dideuteriooxireno[2,3-f]quinoline is [2H]C12C=Cc3ncccc3C1([2H])O2.
What is the InChIKey of 1a,7b-dideuteriooxireno[2,3-f]quinoline?
The InChIKey is DUTMSHWTRSUNIF-XETGXLELSA-N. The full InChI is InChI=1S/C9H7NO/c1-2-6-7(10-5-1)3-4-8-9(6)11-8/h1-5,8-9H/i8D,9D.
What are the key properties of 1a,7b-dideuteriooxireno[2,3-f]quinoline?
1a,7b-dideuteriooxireno[2,3-f]quinoline has a molecular weight of 147.17 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1a,7b-dideuteriooxireno[2,3-f]quinoline is sourced from PubChem (CID 100921913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).