About 4-naphthalen-1-ylsulfinyl-2,3-dihydrofuran
4-naphthalen-1-ylsulfinyl-2,3-dihydrofuran (PubChem CID 100921942) has the molecular formula C14H12O2S
and a molecular weight of 244.32 g/mol. Its IUPAC name is 4-naphthalen-1-ylsulfinyl-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 4-naphthalen-1-ylsulfinyl-2,3-dihydrofuran |
| PubChem CID | 100921942 |
| Molecular Formula | C14H12O2S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 4-naphthalen-1-ylsulfinyl-2,3-dihydrofuran |
| SMILES | O=S(C1=COCC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C14H12O2S/c15-17(12-8-9-16-10-12)14-7-3-5-11-4-1-2-6-13(11)14/h1-7,10H,8-9H2 |
| InChIKey | MONMAGAOGDRYDQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-naphthalen-1-ylsulfinyl-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-naphthalen-1-ylsulfinyl-2,3-dihydrofuran?
The IUPAC name of 4-naphthalen-1-ylsulfinyl-2,3-dihydrofuran (CID 100921942) is 4-naphthalen-1-ylsulfinyl-2,3-dihydrofuran.
What is the SMILES notation for 4-naphthalen-1-ylsulfinyl-2,3-dihydrofuran?
The canonical SMILES for 4-naphthalen-1-ylsulfinyl-2,3-dihydrofuran is O=S(C1=COCC1)c1cccc2ccccc12.
What is the InChIKey of 4-naphthalen-1-ylsulfinyl-2,3-dihydrofuran?
The InChIKey is MONMAGAOGDRYDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2S/c15-17(12-8-9-16-10-12)14-7-3-5-11-4-1-2-6-13(11)14/h1-7,10H,8-9H2.
What are the key properties of 4-naphthalen-1-ylsulfinyl-2,3-dihydrofuran?
4-naphthalen-1-ylsulfinyl-2,3-dihydrofuran has a molecular weight of 244.32 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-naphthalen-1-ylsulfinyl-2,3-dihydrofuran is sourced from PubChem (CID 100921942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).