C13H20O3Se — CID 100922161
(E)-3-[[(1R,2S,4S)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methylselanyl]prop-2-enoic acid (PubChem CID 100922161) has the molecular formula C13H20O3Se and a molecular weight of 303.26 g/mol. Its IUPAC name is (E)-3-[[(1R,2S,4S)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methylselanyl]prop-2-enoic acid.
| Compound Name | (E)-3-[[(1R,2S,4S)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methylselanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 100922161 |
| Molecular Formula | C13H20O3Se |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (E)-3-[[(1R,2S,4S)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methylselanyl]prop-2-enoic acid |
| SMILES | CC1(C)[C@H]2CC[C@]1(C[Se]/C=C/C(=O)O)[C@@H](O)C2 |
| InChI | InChI=1S/C13H20O3Se/c1-12(2)9-3-5-13(12,10(14)7-9)8-17-6-4-11(15)16/h4,6,9-10,14H,3,5,7-8H2,1-2H3,(H,15,16)/b6-4+/t9-,10-,13-/m0/s1 |
| InChIKey | LBOGRFWVOAZANH-SDLONBDTSA-N |
| XLogP | 1.89 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|