C15H26O7S — CID 100922270
(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(propylsulfonylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 100922270) has the molecular formula C15H26O7S and a molecular weight of 350.43 g/mol. Its IUPAC name is (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(propylsulfonylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(propylsulfonylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 100922270 |
| Molecular Formula | C15H26O7S |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(propylsulfonylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CCCS(=O)(=O)C[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C15H26O7S/c1-6-7-23(16,17)8-9-10-11(20-14(2,3)19-10)12-13(18-9)22-15(4,5)21-12/h9-13H,6-8H2,1-5H3/t9-,10+,11+,12-,13-/m1/s1 |
| InChIKey | WCMDWEXRYBYTDW-KSSYENDESA-N |
| XLogP | 1.21 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |