C20H36O7S — CID 100922271
(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(octylsulfonylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 100922271) has the molecular formula C20H36O7S and a molecular weight of 420.57 g/mol. Its IUPAC name is (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(octylsulfonylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(octylsulfonylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 100922271 |
| Molecular Formula | C20H36O7S |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(octylsulfonylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CCCCCCCCS(=O)(=O)C[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C20H36O7S/c1-6-7-8-9-10-11-12-28(21,22)13-14-15-16(25-19(2,3)24-15)17-18(23-14)27-20(4,5)26-17/h14-18H,6-13H2,1-5H3/t14-,15+,16+,17-,18-/m1/s1 |
| InChIKey | OFAUAXXXNXWSMG-DISONHOPSA-N |
| XLogP | 3.16 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|