C27H44O7S — CID 100922274
(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfonylmethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 100922274) has the molecular formula C27H44O7S and a molecular weight of 512.71 g/mol. Its IUPAC name is (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfonylmethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfonylmethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 100922274 |
| Molecular Formula | C27H44O7S |
| Molecular Weight | 512.71 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfonylmethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CS(=O)(=O)C[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C27H44O7S/c1-18(2)11-9-12-19(3)13-10-14-20(4)15-16-35(28,29)17-21-22-23(32-26(5,6)31-22)24-25(30-21)34-27(7,8)33-24/h11,13,15,21-25H,9-10,12,14,16-17H2,1-8H3/b19-13+,20-15+/t21-,22+,23+,24-,25-/m1/s1 |
| InChIKey | GPGFLGADBXUDSW-QLBXLMCXSA-N |
| XLogP | 5.22 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.71 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|