C16H27BrO7S — CID 100922276
(1S,2R,6R,8S,9R)-8-(4-bromobutylsulfonylmethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 100922276) has the molecular formula C16H27BrO7S and a molecular weight of 443.36 g/mol. Its IUPAC name is (1S,2R,6R,8S,9R)-8-(4-bromobutylsulfonylmethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8S,9R)-8-(4-bromobutylsulfonylmethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 100922276 |
| Molecular Formula | C16H27BrO7S |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | (1S,2R,6R,8S,9R)-8-(4-bromobutylsulfonylmethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](CS(=O)(=O)CCCCBr)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C16H27BrO7S/c1-15(2)21-11-10(9-25(18,19)8-6-5-7-17)20-14-13(12(11)22-15)23-16(3,4)24-14/h10-14H,5-9H2,1-4H3/t10-,11+,12+,13-,14-/m1/s1 |
| InChIKey | RDDKBOHRQQNTFH-MBJXGIAVSA-N |
| XLogP | 1.97 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|