C18H31BrO7S — CID 100922277
(1S,2R,6R,8S,9R)-8-(6-bromohexylsulfonylmethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 100922277) has the molecular formula C18H31BrO7S and a molecular weight of 471.41 g/mol. Its IUPAC name is (1S,2R,6R,8S,9R)-8-(6-bromohexylsulfonylmethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8S,9R)-8-(6-bromohexylsulfonylmethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 100922277 |
| Molecular Formula | C18H31BrO7S |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | (1S,2R,6R,8S,9R)-8-(6-bromohexylsulfonylmethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](CS(=O)(=O)CCCCCCBr)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C18H31BrO7S/c1-17(2)23-13-12(11-27(20,21)10-8-6-5-7-9-19)22-16-15(14(13)24-17)25-18(3,4)26-16/h12-16H,5-11H2,1-4H3/t12-,13+,14+,15-,16-/m1/s1 |
| InChIKey | IZBPYLASGVTRFL-LYYZXLFJSA-N |
| XLogP | 2.75 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|