About bis(2,4,6-trimethylphenyl)silane
bis(2,4,6-trimethylphenyl)silane (PubChem CID 100922413) has the molecular formula C18H24Si
and a molecular weight of 268.48 g/mol. Its IUPAC name is bis(2,4,6-trimethylphenyl)silane.
Molecular Properties
| Compound Name | bis(2,4,6-trimethylphenyl)silane |
| PubChem CID | 100922413 |
| Molecular Formula | C18H24Si |
| Molecular Weight | 268.48 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | bis(2,4,6-trimethylphenyl)silane |
| SMILES | Cc1cc(C)c([SiH2]c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C18H24Si/c1-11-7-13(3)17(14(4)8-11)19-18-15(5)9-12(2)10-16(18)6/h7-10H,19H2,1-6H3 |
| InChIKey | GMCSTZIZOSWRBO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(2,4,6-trimethylphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,4,6-trimethylphenyl)silane?
The IUPAC name of bis(2,4,6-trimethylphenyl)silane (CID 100922413) is bis(2,4,6-trimethylphenyl)silane.
What is the SMILES notation for bis(2,4,6-trimethylphenyl)silane?
The canonical SMILES for bis(2,4,6-trimethylphenyl)silane is Cc1cc(C)c([SiH2]c2c(C)cc(C)cc2C)c(C)c1.
What is the InChIKey of bis(2,4,6-trimethylphenyl)silane?
The InChIKey is GMCSTZIZOSWRBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24Si/c1-11-7-13(3)17(14(4)8-11)19-18-15(5)9-12(2)10-16(18)6/h7-10H,19H2,1-6H3.
What are the key properties of bis(2,4,6-trimethylphenyl)silane?
bis(2,4,6-trimethylphenyl)silane has a molecular weight of 268.48 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,4,6-trimethylphenyl)silane is sourced from PubChem (CID 100922413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).