C10H11F3O5 — CID 100922565
(1S,2R,6R,8R,9S)-4,4-dimethyl-9-(trifluoromethyl)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one (PubChem CID 100922565) has the molecular formula C10H11F3O5 and a molecular weight of 268.19 g/mol. Its IUPAC name is (1S,2R,6R,8R,9S)-4,4-dimethyl-9-(trifluoromethyl)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one.
| Compound Name | (1S,2R,6R,8R,9S)-4,4-dimethyl-9-(trifluoromethyl)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one |
|---|---|
| PubChem CID | 100922565 |
| Molecular Formula | C10H11F3O5 |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | (1S,2R,6R,8R,9S)-4,4-dimethyl-9-(trifluoromethyl)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@H](OC(=O)[C@H]3C(F)(F)F)[C@H]2O1 |
| InChI | InChI=1S/C10H11F3O5/c1-9(2)17-6-5-4(16-8(6)18-9)3(7(14)15-5)10(11,12)13/h3-6,8H,1-2H3/t3-,4+,5-,6+,8+/m0/s1 |
| InChIKey | CMYNIAIDDLGSIF-UXTLFEIASA-N |
| XLogP | 0.97 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |