C13H7ClF12O2S — CID 100922652
(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)sulfonylmethylbenzene (PubChem CID 100922652) has the molecular formula C13H7ClF12O2S and a molecular weight of 490.69 g/mol. Its IUPAC name is (6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)sulfonylmethylbenzene.
| Compound Name | (6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)sulfonylmethylbenzene |
|---|---|
| PubChem CID | 100922652 |
| Molecular Formula | C13H7ClF12O2S |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | (6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)sulfonylmethylbenzene |
| SMILES | O=S(=O)(Cc1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C13H7ClF12O2S/c14-12(23,24)10(19,20)8(15,16)9(17,18)11(21,22)13(25,26)29(27,28)6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | XSOFTGYPZKROJE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|