C13H15ClN4O6S — CID 100922864
[(3aS,5R,6S,6aR)-5-(6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate (PubChem CID 100922864) has the molecular formula C13H15ClN4O6S and a molecular weight of 390.81 g/mol. Its IUPAC name is [(3aS,5R,6S,6aR)-5-(6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate.
| Compound Name | [(3aS,5R,6S,6aR)-5-(6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate |
|---|---|
| PubChem CID | 100922864 |
| Molecular Formula | C13H15ClN4O6S |
| Molecular Weight | 390.81 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | [(3aS,5R,6S,6aR)-5-(6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate |
| SMILES | CC1(C)O[C@@H]2O[C@H](c3nnc4ccc(Cl)nn34)[C@H](OS(C)(=O)=O)[C@H]2O1 |
| InChI | InChI=1S/C13H15ClN4O6S/c1-13(2)22-10-8(24-25(3,19)20)9(21-12(10)23-13)11-16-15-7-5-4-6(14)17-18(7)11/h4-5,8-10,12H,1-3H3/t8-,9-,10+,12-/m0/s1 |
| InChIKey | JZZHEUTYVBWSLG-GUDRVLHUSA-N |
| XLogP | 0.67 |
| TPSA | 114.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.81 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|