C40H78O2 — CID 100923630
(2R,3R)-2-methyl-3-[2-[(2S,3S)-3-methyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]oxiran-2-yl]ethyl]-2-[(4R,8R)-4,8,12-trimethyltridecyl]oxirane (PubChem CID 100923630) has the molecular formula C40H78O2 and a molecular weight of 591.06 g/mol. Its IUPAC name is (2R,3R)-2-methyl-3-[2-[(2S,3S)-3-methyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]oxiran-2-yl]ethyl]-2-[(4R,8R)-4,8,12-trimethyltridecyl]oxirane.
| Compound Name | (2R,3R)-2-methyl-3-[2-[(2S,3S)-3-methyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]oxiran-2-yl]ethyl]-2-[(4R,8R)-4,8,12-trimethyltridecyl]oxirane |
|---|---|
| PubChem CID | 100923630 |
| Molecular Formula | C40H78O2 |
| Molecular Weight | 591.06 g/mol |
| Exact Mass | 590.60 |
| IUPAC Name | (2R,3R)-2-methyl-3-[2-[(2S,3S)-3-methyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]oxiran-2-yl]ethyl]-2-[(4R,8R)-4,8,12-trimethyltridecyl]oxirane |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@@]1(C)O[C@@H]1CC[C@@H]1O[C@@]1(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C40H78O2/c1-31(2)17-11-19-33(5)21-13-23-35(7)25-15-29-39(9)37(41-39)27-28-38-40(10,42-38)30-16-26-36(8)24-14-22-34(6)20-12-18-32(3)4/h31-38H,11-30H2,1-10H3/t33-,34-,35-,36-,37-,38+,39-,40+/m1/s1 |
| InChIKey | DMYYYVUFMVHYNX-UBNURDABSA-N |
| XLogP | 12.96 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.06 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|