C17H20O11 — CID 10092371
pentamethyl 5-(methoxymethyl)cyclopenta-1,3-diene-1,2,3,4,5-pentacarboxylate (PubChem CID 10092371) has the molecular formula C17H20O11 and a molecular weight of 400.34 g/mol. Its IUPAC name is pentamethyl 5-(methoxymethyl)cyclopenta-1,3-diene-1,2,3,4,5-pentacarboxylate.
| Compound Name | pentamethyl 5-(methoxymethyl)cyclopenta-1,3-diene-1,2,3,4,5-pentacarboxylate |
|---|---|
| PubChem CID | 10092371 |
| Molecular Formula | C17H20O11 |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | pentamethyl 5-(methoxymethyl)cyclopenta-1,3-diene-1,2,3,4,5-pentacarboxylate |
| SMILES | COCC1(C(=O)OC)C(C(=O)OC)=C(C(=O)OC)C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C17H20O11/c1-23-7-17(16(22)28-6)10(14(20)26-4)8(12(18)24-2)9(13(19)25-3)11(17)15(21)27-5/h7H2,1-6H3 |
| InChIKey | VOMUIIRLIMENGQ-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|