C16H22O3S — CID 100924241
(4S,5S)-2,2-dimethyl-4-[(4-methylphenyl)sulfinylmethyl]-5-prop-2-enyl-1,3-dioxolane (PubChem CID 100924241) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is (4S,5S)-2,2-dimethyl-4-[(4-methylphenyl)sulfinylmethyl]-5-prop-2-enyl-1,3-dioxolane.
| Compound Name | (4S,5S)-2,2-dimethyl-4-[(4-methylphenyl)sulfinylmethyl]-5-prop-2-enyl-1,3-dioxolane |
|---|---|
| PubChem CID | 100924241 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (4S,5S)-2,2-dimethyl-4-[(4-methylphenyl)sulfinylmethyl]-5-prop-2-enyl-1,3-dioxolane |
| SMILES | C=CC[C@@H]1OC(C)(C)O[C@@H]1CS(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H22O3S/c1-5-6-14-15(19-16(3,4)18-14)11-20(17)13-9-7-12(2)8-10-13/h5,7-10,14-15H,1,6,11H2,2-4H3/t14-,15+,20?/m0/s1 |
| InChIKey | VCAPONPMCKYHAC-VKWYCSODSA-N |
| XLogP | 3.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|