C14H22OS — CID 100924600
(2S,3S)-3-(4-tert-butylphenyl)sulfanylbutan-2-ol (PubChem CID 100924600) has the molecular formula C14H22OS and a molecular weight of 238.40 g/mol. Its IUPAC name is (2S,3S)-3-(4-tert-butylphenyl)sulfanylbutan-2-ol.
| Compound Name | (2S,3S)-3-(4-tert-butylphenyl)sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 100924600 |
| Molecular Formula | C14H22OS |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (2S,3S)-3-(4-tert-butylphenyl)sulfanylbutan-2-ol |
| SMILES | C[C@H](O)[C@H](C)Sc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C14H22OS/c1-10(15)11(2)16-13-8-6-12(7-9-13)14(3,4)5/h6-11,15H,1-5H3/t10-,11-/m0/s1 |
| InChIKey | SLKUSFVWTAYAPP-QWRGUYRKSA-N |
| XLogP | 3.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |