C27H31NO2 — CID 10092463
(5S)-10-methoxy-2,2,4-trimethyl-5-[(1R)-3-methylcyclohex-2-en-1-yl]-1,5-dihydrochromeno[3,4-f]quinoline (PubChem CID 10092463) has the molecular formula C27H31NO2 and a molecular weight of 401.55 g/mol. Its IUPAC name is (5S)-10-methoxy-2,2,4-trimethyl-5-[(1R)-3-methylcyclohex-2-en-1-yl]-1,5-dihydrochromeno[3,4-f]quinoline.
| Compound Name | (5S)-10-methoxy-2,2,4-trimethyl-5-[(1R)-3-methylcyclohex-2-en-1-yl]-1,5-dihydrochromeno[3,4-f]quinoline |
|---|---|
| PubChem CID | 10092463 |
| Molecular Formula | C27H31NO2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (5S)-10-methoxy-2,2,4-trimethyl-5-[(1R)-3-methylcyclohex-2-en-1-yl]-1,5-dihydrochromeno[3,4-f]quinoline |
| SMILES | COc1cccc2c1-c1ccc3c(c1[C@H]([C@H]1C=C(C)CCC1)O2)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C27H31NO2/c1-16-8-6-9-18(14-16)26-25-19(24-21(29-5)10-7-11-22(24)30-26)12-13-20-23(25)17(2)15-27(3,4)28-20/h7,10-15,18,26,28H,6,8-9H2,1-5H3/t18-,26+/m1/s1 |
| InChIKey | ZOUVODOOOFQPOC-DWXRJYCRSA-N |
| XLogP | 7.15 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|